mirror of
https://github.com/catlog22/Claude-Code-Workflow.git
synced 2026-02-12 02:37:45 +08:00
Based on Gemini CLI analysis, updated all command documentation to align with current Single Source of Truth (SSoT) architecture. ## Key Updates ### Command Reference Modernization - Updated all `/task:context` and `/workflow:context` references to unified `/context` command - Removed all references to deprecated `/task:sync` and `/workflow:sync` commands - Updated related commands sections across all task and workflow files ### Architecture Alignment - Clarified JSON-first data model where `.task/*.json` files are authoritative - Updated descriptions to reflect that markdown files are generated views, not synchronized documents - Removed outdated "bidirectional sync" concepts in favor of automatic data consistency ### File Reference Standardization - Fixed `TODO_CHECKLIST.md` → `TODO_LIST.md` naming inconsistencies - Updated workflow integration examples to use proper command names - Standardized command integration descriptions ### Documentation Consistency - Aligned task creation, breakdown, execution, and replanning documentation with current architecture - Updated workflow issue integration to reflect JSON-based task creation - Enhanced CHANGELOG.md with comprehensive documentation modernization details ## Impact - Eliminates confusion about deprecated commands - Provides accurate guidance on current system behavior - Aligns documentation with actual implementation - Reduces maintenance overhead by removing outdated synchronization concepts 🤖 Generated with [Claude Code](https://claude.ai/code) Co-Authored-By: Claude <noreply@anthropic.com>
356 lines
12 KiB
Markdown
356 lines
12 KiB
Markdown
---
|
|
name: workflow-issue
|
|
description: Comprehensive issue and change request management within workflow sessions
|
|
usage: /workflow:issue <subcommand> [options]
|
|
argument-hint: create|list|update|integrate|close [additional parameters]
|
|
examples:
|
|
- /workflow:issue create --type=feature "Add OAuth2 social login support"
|
|
- /workflow:issue create --type=bug --priority=high "User avatar security vulnerability"
|
|
- /workflow:issue list
|
|
- /workflow:issue list --status=open --priority=high
|
|
- /workflow:issue update ISS-001 --status=integrated --priority=medium
|
|
- /workflow:issue integrate ISS-001 --position=after-current
|
|
- /workflow:issue close ISS-002 --reason="Duplicate of ISS-001"
|
|
---
|
|
|
|
### 🚀 Command Overview: `/workflow:issue`
|
|
|
|
- **Purpose**: A comprehensive issue and change request management system for use within workflow sessions.
|
|
- **Function**: Enables dynamic creation, tracking, integration, and closure of tasks and changes.
|
|
|
|
### 🏛️ Subcommand Architecture
|
|
|
|
- **`create`**: Creates a new issue or change request.
|
|
- **`list`**: Lists and filters existing issues.
|
|
- **`update`**: Modifies the status, priority, or other attributes of an issue.
|
|
- **`integrate`**: Integrates an issue into the current workflow plan.
|
|
- **`close`**: Closes a completed or obsolete issue.
|
|
|
|
### 📜 Core Principles
|
|
|
|
- **Dynamic Change Management**: @~/.claude/workflows/dynamic-change-management.md
|
|
- **Session State Management**: @~/.claude/workflows/session-management-principles.md
|
|
- **TodoWrite Coordination Rules**: @~/.claude/workflows/todowrite-coordination-rules.md
|
|
|
|
### (1) Subcommand: `create`
|
|
|
|
Creates a new issue or change request.
|
|
|
|
- **Syntax**: `/workflow:issue create [options] "issue description"`
|
|
- **Options**:
|
|
- `--type=<type>`: `feature|bug|optimization|refactor|documentation`
|
|
- `--priority=<priority>`: `critical|high|medium|low`
|
|
- `--category=<category>`: `frontend|backend|database|testing|deployment`
|
|
- `--estimated-impact=<impact>`: `high|medium|low`
|
|
- `--blocking`: Marks the issue as a blocker.
|
|
- `--parent=<issue-id>`: Specifies a parent issue for creating a sub-task.
|
|
|
|
### (2) Subcommand: `list`
|
|
|
|
Lists and filters all issues related to the current workflow.
|
|
|
|
- **Syntax**: `/workflow:issue list [options]`
|
|
- **Options**:
|
|
- `--status=<status>`: Filter by `open|integrated|completed|closed`.
|
|
- `--type=<type>`: Filter by issue type.
|
|
- `--priority=<priority>`: Filter by priority level.
|
|
- `--category=<category>`: Filter by category.
|
|
- `--blocking-only`: Shows only blocking issues.
|
|
- `--sort=<field>`: Sort by `priority|created|updated|impact`.
|
|
- `--detailed`: Displays more detailed information for each issue.
|
|
|
|
### (3) Subcommand: `update`
|
|
|
|
Updates attributes of an existing issue.
|
|
|
|
- **Syntax**: `/workflow:issue update <issue-id> [options]`
|
|
- **Options**:
|
|
- `--status=<status>`: Update issue status.
|
|
- `--priority=<priority>`: Update issue priority.
|
|
- `--description="<new-desc>"`: Update the description.
|
|
- `--category=<category>`: Update the category.
|
|
- `--estimated-impact=<impact>`: Update estimated impact.
|
|
- `--add-comment="<comment>"`: Add a new comment to the issue history.
|
|
- `--assign-to=<assignee>`: Assign the issue to a person or team.
|
|
- `--blocking` / `--non-blocking`: Change the blocking status.
|
|
|
|
### (4) Subcommand: `integrate`
|
|
|
|
Integrates a specified issue into the current workflow plan.
|
|
|
|
- **Syntax**: `/workflow:issue integrate <issue-id> [options]`
|
|
- **Options**:
|
|
- `--position=<position>`: `immediate|after-current|next-phase|end-of-workflow`
|
|
- `--mode=<mode>`: `insert|replace|merge`
|
|
- `--impact-analysis`: Performs a detailed impact analysis before integration.
|
|
- `--auto-replan`: Automatically replans the workflow after integration.
|
|
- `--preserve-dependencies`: Tries to maintain existing task dependencies.
|
|
- `--dry-run`: Simulates integration without making actual changes.
|
|
- **Execution Logic**:
|
|
```pseudo
|
|
FUNCTION integrate_issue(issue_id, options):
|
|
// Perform an analysis of how the issue affects the project plan.
|
|
analysis_report = create_impact_analysis(issue_id, options)
|
|
present_report_to_user(analysis_report)
|
|
|
|
// Require explicit user confirmation before modifying the workflow.
|
|
user_response = get_user_input("Confirm integration? (y/N)")
|
|
|
|
IF user_response is "y":
|
|
log("Executing integration...")
|
|
// These steps correspond to the "集成步骤" in the example output.
|
|
update_document("IMPL_PLAN.md")
|
|
create_task_json_files("issue integration")
|
|
update_tool_state("TodoWrite")
|
|
update_session_file("workflow-session.json")
|
|
log("Integration complete!")
|
|
ELSE:
|
|
log("Integration cancelled by user.")
|
|
HALT_OPERATION()
|
|
END FUNCTION
|
|
```
|
|
|
|
### (5) Subcommand: `close`
|
|
|
|
Closes an issue that is completed or no longer relevant.
|
|
|
|
- **Syntax**: `/workflow:issue close <issue-id> [options]`
|
|
- **Options**:
|
|
- `--reason=<reason>`: `completed|duplicate|wont-fix|invalid`
|
|
- `--comment="<comment>"`: Provides a final closing comment.
|
|
- `--reference=<issue-id>`: References a related issue (e.g., a duplicate).
|
|
- `--auto-cleanup`: Automatically cleans up references to this issue in other documents.
|
|
|
|
### ✨ Advanced Features
|
|
|
|
- **Batch Operations**:
|
|
- Update multiple issues at once: `/workflow:issue update ISS-001,ISS-002 --priority=high`
|
|
- Integrate a parent issue with its children: `/workflow:issue integrate ISS-001,ISS-001-1,ISS-001-2`
|
|
- **Smart Analysis**:
|
|
- Performs conflict detection, dependency analysis, priority suggestions, and effort estimations.
|
|
- **Reporting**:
|
|
- Generate reports on impact or priority: `/workflow:issue report --type=impact`
|
|
|
|
### 🤝 Command Integrations
|
|
|
|
- **Automatic Triggers**:
|
|
- `/context`: Displays the status of relevant issues and their integration with tasks.
|
|
- `/workflow:replan`: Can be automatically called by `integrate` to update the plan.
|
|
- Issues are automatically integrated with the JSON-based workflow state.
|
|
- **Shared Data**:
|
|
- `workflow-session.json`: Stores core issue data and statistics.
|
|
- `WORKFLOW_ISSUES.md`: Provides a human-readable tracking document.
|
|
- `CHANGE_LOG.md`: Logs all historical changes related to issues.
|
|
|
|
### 🗄️ File Generation System
|
|
|
|
- **Process Flow**: All issue operations trigger a file system update.
|
|
`Issue Operation` -> `Generate/Update issues/ISS-###.json` -> `Update WORKFLOW_ISSUES.md` -> `Update workflow-session.json`
|
|
|
|
### 📄 Template: Individual Issue File (`issues/ISS-###.json`)
|
|
|
|
This file stores all details for a single issue.
|
|
|
|
```json
|
|
{
|
|
"id": "ISS-003",
|
|
"title": "Add OAuth2 social login support",
|
|
"description": "Add OAuth2 social login support (Google, GitHub, Facebook)",
|
|
"type": "feature",
|
|
"priority": "high",
|
|
"category": "backend",
|
|
"status": "open",
|
|
"estimated_impact": "medium",
|
|
"blocking": false,
|
|
"created_at": "2025-01-15T14:30:00Z",
|
|
"created_by": "WFS-2025-001",
|
|
"parent_issue": null,
|
|
"sub_issues": [],
|
|
"integration": {
|
|
"status": "pending",
|
|
"position": "after-current",
|
|
"estimated_effort": "6h",
|
|
"dependencies": []
|
|
},
|
|
"history": [
|
|
{
|
|
"action": "created",
|
|
"timestamp": "2025-01-15T14:30:00Z",
|
|
"details": "Initial issue creation"
|
|
}
|
|
],
|
|
"metadata": {
|
|
"session_id": "WFS-2025-001",
|
|
"version": "1.0"
|
|
}
|
|
}
|
|
```
|
|
|
|
### 📋 Template: Tracking Master File (`WORKFLOW_ISSUES.md`)
|
|
|
|
This Markdown file provides a human-readable overview of all issues.
|
|
|
|
```markdown
|
|
# Workflow Issues Tracking
|
|
*Session: WFS-2025-001 | Updated: 2025-01-15 14:30:00*
|
|
|
|
## Issue Summary
|
|
- **Total Issues**: 3
|
|
- **Open**: 2
|
|
- **In Progress**: 1
|
|
- **Closed**: 0
|
|
- **Blocking Issues**: 0
|
|
|
|
## Open Issues
|
|
|
|
### 🔥 High Priority
|
|
- **[ISS-003](issues/ISS-003.json)** - Add OAuth2 social login support
|
|
- Type: Feature | Category: Backend | Created: 2025-01-15
|
|
- Status: Open | Impact: Medium
|
|
- Integration: Pending (after current phase)
|
|
|
|
- **[ISS-001](issues/ISS-001.json)** - User avatar security vulnerability
|
|
- Type: Bug | Category: Frontend | Created: 2025-01-14
|
|
- Status: Open | Impact: High | 🚫 **BLOCKING**
|
|
- Integration: Immediate (critical security fix)
|
|
|
|
### 📊 Medium Priority
|
|
- **[ISS-002](issues/ISS-002.json)** - Database performance optimization
|
|
- Type: Optimization | Category: Database | Created: 2025-01-14
|
|
- Status: In Progress | Impact: High
|
|
- Integration: Phase 3 (optimization phase)
|
|
|
|
## Integration Queue
|
|
1. **ISS-001** - Immediate (blocking security issue)
|
|
2. **ISS-002** - Phase 3 (performance optimization)
|
|
3. **ISS-003** - After current phase (new feature)
|
|
|
|
## Recent Activity
|
|
- **2025-01-15 14:30** - ISS-003 created: Add OAuth2 social login support
|
|
- **2025-01-15 10:15** - ISS-002 status updated: In Progress
|
|
- **2025-01-14 16:45** - ISS-001 created: User avatar security vulnerability
|
|
|
|
---
|
|
*Generated by /workflow:issue create*
|
|
```
|
|
|
|
### 📁 Template: File Storage Structure
|
|
|
|
The command organizes all related files within a dedicated workflow directory.
|
|
|
|
```
|
|
.workflow/WFS-[topic-slug]/
|
|
├── WORKFLOW_ISSUES.md # 主问题跟踪文件
|
|
├── issues/ # 个别问题详情目录
|
|
│ ├── ISS-001.json # 问题详细信息
|
|
│ ├── ISS-002.json
|
|
│ ├── ISS-003.json
|
|
│ └── archive/ # 已关闭问题存档
|
|
│ └── ISS-###.json
|
|
├── issue-reports/ # 问题报告和分析
|
|
│ ├── priority-analysis.md
|
|
│ ├── integration-impact.md
|
|
│ └── resolution-summary.md
|
|
└── workflow-session.json # 会话状态更新
|
|
```
|
|
|
|
### 🔄 Template: Session State Update (`workflow-session.json`)
|
|
|
|
This file is updated after each issue operation to reflect the new state.
|
|
|
|
```json
|
|
{
|
|
"issues": {
|
|
"total_count": 3,
|
|
"open_count": 2,
|
|
"blocking_count": 1,
|
|
"last_issue_id": "ISS-003",
|
|
"integration_queue": ["ISS-001", "ISS-002", "ISS-003"]
|
|
},
|
|
"documents": {
|
|
"WORKFLOW_ISSUES.md": {
|
|
"status": "updated",
|
|
"path": ".workflow/WFS-[topic-slug]/WORKFLOW_ISSUES.md",
|
|
"last_updated": "2025-01-15T14:30:00Z",
|
|
"type": "issue_tracking"
|
|
},
|
|
"issues": {
|
|
"ISS-003.json": {
|
|
"status": "generated",
|
|
"path": ".workflow/WFS-[topic-slug]/issues/ISS-003.json",
|
|
"created_at": "2025-01-15T14:30:00Z",
|
|
"type": "issue_detail",
|
|
"priority": "high",
|
|
"blocking": false
|
|
}
|
|
}
|
|
},
|
|
"recent_activity": [
|
|
{
|
|
"type": "issue_created",
|
|
"issue_id": "ISS-003",
|
|
"timestamp": "2025-01-15T14:30:00Z",
|
|
"description": "Add OAuth2 social login support"
|
|
}
|
|
]
|
|
}
|
|
```
|
|
|
|
### 🧱 Issue Data Structure
|
|
|
|
The canonical JSON structure for an issue object.
|
|
|
|
```json
|
|
{
|
|
"id": "ISS-001",
|
|
"type": "feature|bug|optimization|refactor|documentation",
|
|
"status": "open|integrated|in-progress|completed|closed",
|
|
"priority": "critical|high|medium|low",
|
|
"category": "frontend|backend|database|testing|deployment",
|
|
"blocking": false,
|
|
|
|
"metadata": {
|
|
"title": "OAuth2 social login support",
|
|
"description": "Add OAuth2 integration for Google, GitHub, Facebook",
|
|
"created_at": "2025-01-15T14:30:00Z",
|
|
"updated_at": "2025-01-15T15:45:00Z",
|
|
"created_by": "workflow-session:WFS-2025-001"
|
|
},
|
|
|
|
"estimation": {
|
|
"impact": "high|medium|low",
|
|
"effort": "2-4 hours|1-2 days|3-5 days",
|
|
"complexity": "simple|medium|complex"
|
|
},
|
|
|
|
"integration": {
|
|
"integrated_at": "2025-01-15T16:00:00Z",
|
|
"position": "after-current",
|
|
"affected_documents": ["IMPL_PLAN.md"],
|
|
"added_tasks": 5,
|
|
"modified_tasks": 2
|
|
},
|
|
|
|
"relationships": {
|
|
"parent": "ISS-000",
|
|
"children": ["ISS-001-1", "ISS-001-2"],
|
|
"blocks": ["ISS-002"],
|
|
"blocked_by": [],
|
|
"relates_to": ["ISS-003"]
|
|
},
|
|
|
|
"comments": [
|
|
{
|
|
"timestamp": "2025-01-15T15:30:00Z",
|
|
"content": "需要考虑用户隐私设置集成",
|
|
"type": "note|decision|change"
|
|
}
|
|
],
|
|
|
|
"closure": {
|
|
"closed_at": "2025-01-16T10:30:00Z",
|
|
"reason": "completed|duplicate|wont-fix|invalid",
|
|
"final_comment": "功能实现完成,测试通过"
|
|
}
|
|
}
|
|
``` |